CAS 13161-77-8
:trans-3-Octadecenoic acid
Description:
Trans-3-Octadecenoic acid, also known as trans-3-octadecenoate or trans-3-octadecenoic acid, is a long-chain unsaturated fatty acid characterized by the presence of a double bond in the trans configuration at the third carbon from the carboxylic acid end of the molecule. It has a molecular formula of C18H34O2 and features a hydrophobic hydrocarbon tail, which contributes to its lipid-soluble properties. This fatty acid is typically found in various natural sources, including certain plant oils and animal fats. Its trans configuration distinguishes it from its cis counterpart, influencing its physical properties, such as melting point and solubility. Trans-3-Octadecenoic acid is of interest in both nutritional and industrial contexts, as it may have implications for human health and is utilized in the synthesis of various chemical compounds. Additionally, it can participate in biochemical processes and may affect membrane fluidity and function in biological systems.
Formula:C18H34O2
InChI:InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h15-16H,2-14,17H2,1H3,(H,19,20)/b16-15+
InChI key:InChIKey=DLPRXTUOPLIHNV-FOCLMDBBSA-N
SMILES:C(CCCCCCCCCCC)CC/C=C/CC(O)=O
Synonyms:- (3E)-3-Octadecenoic acid
- trans-3-Octadecenoic acid
- 3-Octadecenoic acid, (3E)-
- (E)-3-Octadecenoic acid
- 3-Octadecenoic acid, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
