CymitQuimica logo

CAS 13162-24-8

:

4-chloro-6-methyl-5-nitro-pyrimidin-2-amine

Description:
4-Chloro-6-methyl-5-nitro-pyrimidin-2-amine is a heterocyclic organic compound belonging to the pyrimidine family, characterized by a pyrimidine ring substituted with various functional groups. The presence of a chlorine atom at the 4-position, a methyl group at the 6-position, and a nitro group at the 5-position, along with an amino group at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its nitro group may impart some degree of reactivity, making it a potential candidate for further chemical transformations. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 4-chloro-6-methyl-5-nitro-pyrimidin-2-amine is a versatile compound with applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C5H8ClN5
InChI:InChI=1/C5H8ClN5/c1-9-4-2(7)3(6)10-5(8)11-4/h7H2,1H3,(H3,8,9,10,11)
SMILES:CN=c1c(c(Cl)[nH]c(=N)[nH]1)N
Synonyms:
  • 2-amino-6-methyl-5-nitropyrimidin-4(3H)-one
  • 6-chloro-N4-methylpyrimidine-2,4,5-triamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.