CAS 13162-25-9

5-Bromo-6-methyl-2,4-pyrimidinediamine

Description:

5-Bromo-6-methyl-2,4-pyrimidinediamine, with the CAS number 13162-25-9, is an organic compound belonging to the pyrimidine family. It features a pyrimidine ring substituted with a bromine atom at the 5-position and a methyl group at the 6-position, along with two amino groups at the 2 and 4 positions. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Its molecular structure contributes to its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive compounds. The presence of the bromine atom may impart unique reactivity, making it useful in further chemical transformations. Additionally, the compound's properties, such as melting point and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₇BrN₄

InChI: InChI=1S/C5H7BrN4/c1-2-3(6)4(7)10-5(8)9-2/h1H3,(H4,7,8,9,10)

InChI key: InChIKey=WDGRTTDQMCWULL-UHFFFAOYSA-N

SMILES: BrC=1C(C)=NC(N)=NC1N

Synonyms:

• 5-Bromo-6-methyl-2,4-pyrimidinediamine
• Pyrimidine, 2,4-diamino-5-bromo-6-methyl-
• 2,4-Pyrimidinediamine, 5-bromo-6-methyl-