CAS 13162-26-0

2,4-dichloro-6-methyl-5-nitropyrimidine

Description:

2,4-Dichloro-6-methyl-5-nitropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which contains two chlorine atoms, a methyl group, and a nitro group. The presence of these substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro and chloro groups, which can influence its reactivity and stability. Additionally, the compound may possess biological activity, making it of interest for research in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2,4-dichloro-6-methyl-5-nitropyrimidine is a significant compound in synthetic organic chemistry with potential utility in various applications.

Formula: C₅H₃Cl₂N₃O₂

InChI: InChI=1/C5H3Cl2N3O2/c1-2-3(10(11)12)4(6)9-5(7)8-2/h1H3

SMILES: Cc1c(c(Cl)nc(Cl)n1)N(=O)=O

Synonyms:

• 2,4-Dichloro-5-nitro-6-methylpyrimidine
• 2,4-Dichloro-6-Methyl-5-Nitro
• Pyrimidine, 2,4-dichloro-6-methyl-5-nitro-
• 2,6-Dichloro-4-Methyl-5-Nitropyrimidine

Pyrimidine, 2,4-dichloro-6-methyl-5-nitro-

CAS: 13162-26-0

Formula: C₅H₃Cl₂N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.0022

Ref: IN-DA000ZJ2

2,4-Dichloro-6-methyl-5-nitropyrimidine

CAS: 13162-26-0

2,4-Dichloro-6-methyl-5-nitropyrimidine

Purity: 97%

Molecular weight: 208.00222g/mol

Ref: 54-OR2742

2,4-Dichloro-6-methyl-5-nitropyrimidine

CAS: 13162-26-0

Formula: C₅H₃Cl₂N₃O₂

Purity: 98%

Color and Shape: Solid, Powder

Molecular weight: 208

Ref: 10-F049483

2,4-Dichloro-6-methyl-5-nitropyrimidine

Controlled Product

CAS: 13162-26-0

Stability Moisture Sensitive
Applications A synthetic intermediate

Formula: C₅H₃Cl₂N₃O₂

Color and Shape: Neat

Molecular weight: 208.00

Ref: TR-D435450