CymitQuimica logo

CAS 13162-27-1

:

2,4-DICHLORO-5-AMINO-6-METHYLPYRIMIDINE

Description:
2,4-Dichloro-5-amino-6-methylpyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two chlorine substituents at the 2 and 4 positions, an amino group at the 5 position, and a methyl group at the 6 position of the pyrimidine ring. It is typically a solid at room temperature and may appear as a crystalline or powder form. The presence of chlorine atoms contributes to its reactivity and potential applications in various chemical reactions, while the amino group can participate in hydrogen bonding and nucleophilic substitution reactions. This compound is of interest in pharmaceutical chemistry and agricultural applications, particularly as a building block in the synthesis of herbicides or other biologically active molecules. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling and usage guidelines.
Formula:C5H5Cl2N3
InChI:InChI=1/C5H5Cl2N3/c1-2-3(8)4(6)10-5(7)9-2/h8H2,1H3
InChI key:FDMMHWIFYCXEOF-UHFFFAOYSA-N
SMILES:Cc1c(c(Cl)nc(Cl)n1)N
Synonyms:
  • 2,4-Dichloro-6-Methyl-Pyrimidin-5-Ylamine
  • 2,4-Dichloro-6-Methyl-Pyrimidin-5-Amine
Found 5 products.