CymitQuimica logo

CAS 13162-47-5

:

2,4-Dodecadienal

Description:
2,4-Dodecadienal is an organic compound characterized by its long carbon chain and the presence of two double bonds, specifically located at the 2nd and 4th positions of the dodecane backbone. It is classified as an aldehyde due to the terminal carbonyl group (-CHO) at one end of the molecule. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor, often described as fatty or waxy. Its molecular formula is C12H22O, and it has a relatively low boiling point, which is common for aldehydes of similar structure. 2,4-Dodecadienal is soluble in organic solvents but has limited solubility in water. It is used in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Additionally, due to its unsaturated nature, it can participate in various chemical reactions, such as polymerization and oxidation. Safety precautions should be taken when handling this compound, as with many aldehydes, due to potential irritant properties.
Formula:C12H20O
InChI:InChI=1S/C12H20O/c1-2-3-4-5-6-7-8-9-10-11-12-13/h8-12H,2-7H2,1H3
InChI key:InChIKey=QKTZBZWNADPFOL-UHFFFAOYSA-N
SMILES:C(CCCCCC)C=CC=CC=O
Synonyms:
  • 2,4-Dodecadienal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.