CymitQuimica logo

CAS 1316217-24-9

:

1-[3-(5-Bromo-2-pyridinyl)-1-piperidinyl]ethanone

Description:
1-[3-(5-Bromo-2-pyridinyl)-1-piperidinyl]ethanone, identified by its CAS number 1316217-24-9, is a chemical compound characterized by its complex structure that includes a piperidine ring and a pyridine moiety. The presence of the bromine atom on the pyridine ring contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, which may influence its solubility, stability, and interaction with biological systems. It is often studied in the context of medicinal chemistry due to its potential applications in drug development, particularly in targeting specific receptors or enzymes. The functional groups present in the molecule, such as the ketone group, can also play a significant role in its reactivity and interactions. Overall, this compound represents a class of molecules that may have significant implications in pharmacology and organic synthesis.
Formula:C12H15BrN2O
InChI:InChI=1S/C12H15BrN2O/c1-9(16)15-6-2-3-10(8-15)12-5-4-11(13)7-14-12/h4-5,7,10H,2-3,6,8H2,1H3
InChI key:InChIKey=BRXHSBDMHOXRMO-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CC(CCC1)C2=CC=C(Br)C=N2
Synonyms:
  • 1-[3-(5-Bromo-2-pyridinyl)-1-piperidinyl]ethanone
  • Ethanone, 1-[3-(5-bromo-2-pyridinyl)-1-piperidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.