
CAS 1316217-38-5
:1-[2,4′-Bipiperidin]-1-yl-2-(2-fluorophenyl)ethanone
Description:
1-[2,4′-Bipiperidin]-1-yl-2-(2-fluorophenyl)ethanone, identified by its CAS number 1316217-38-5, is a chemical compound characterized by its unique structural features, which include a bipiperidine moiety and a fluorophenyl group. This compound typically exhibits properties associated with piperidine derivatives, such as potential basicity due to the nitrogen atoms in the piperidine rings. The presence of the fluorine atom in the phenyl group can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity. The ethanone functional group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as solubility, melting point, and stability, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound represents a class of organic molecules with potential applications in pharmaceuticals and chemical research.
Formula:C18H25FN2O
InChI:InChI=1S/C18H25FN2O/c19-16-6-2-1-5-15(16)13-18(22)21-12-4-3-7-17(21)14-8-10-20-11-9-14/h1-2,5-6,14,17,20H,3-4,7-13H2
InChI key:InChIKey=BRUPQZFSBBKPDM-UHFFFAOYSA-N
SMILES:C(CC1=C(F)C=CC=C1)(=O)N2C(CCCC2)C3CCNCC3
Synonyms:- Ethanone, 1-[2,4′-bipiperidin]-1-yl-2-(2-fluorophenyl)-
- 1-[2,4′-Bipiperidin]-1-yl-2-(2-fluorophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.