CymitQuimica logo

CAS 1316217-46-5

:

5-Methoxy-2-(phenylmethyl)-2H-indazole-3-carboxylic acid

Description:
5-Methoxy-2-(phenylmethyl)-2H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methoxy group (-OCH3) at the 5-position and a phenylmethyl group (-CH2C6H5) at the 2-position contributes to its unique properties, including potential biological activity. The carboxylic acid functional group (-COOH) at the 3-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems. As with many indazole derivatives, it may be investigated for applications in areas such as anti-inflammatory, analgesic, or anticancer therapies. However, specific biological activities and safety profiles would require further empirical research.
Formula:C16H14N2O3
InChI:InChI=1S/C16H14N2O3/c1-21-12-7-8-14-13(9-12)15(16(19)20)18(17-14)10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,19,20)
InChI key:InChIKey=XVIRQVACKUASTK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=NN1CC3=CC=CC=C3)C=CC(OC)=C2
Synonyms:
  • 5-Methoxy-2-(phenylmethyl)-2H-indazole-3-carboxylic acid
  • 2H-Indazole-3-carboxylic acid, 5-methoxy-2-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.