CAS 1316217-51-2

2-Chloro-6-[[1-(methylsulfonyl)-3-piperidinyl]methyl]pyrazine

Description:

2-Chloro-6-[[1-(methylsulfonyl)-3-piperidinyl]methyl]pyrazine is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with a chlorine atom and a piperidine moiety linked through a methyl group. This compound features a methylsulfonyl group, which enhances its solubility and reactivity. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The presence of the chlorine atom suggests potential for electrophilic reactions, while the piperidine ring contributes to its basicity and potential interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could influence its biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken.

Formula: C₁₁H₁₆ClN₃O₂S

InChI: InChI=1S/C11H16ClN3O2S/c1-18(16,17)15-4-2-3-9(8-15)5-10-6-13-7-11(12)14-10/h6-7,9H,2-5,8H2,1H3

InChI key: InChIKey=UCHRILDXEDYYQX-UHFFFAOYSA-N

SMILES: C(C1CN(S(C)(=O)=O)CCC1)C2=NC(Cl)=CN=C2

Synonyms:

• Pyrazine, 2-chloro-6-[[1-(methylsulfonyl)-3-piperidinyl]methyl]-
• 2-Chloro-6-[[1-(methylsulfonyl)-3-piperidinyl]methyl]pyrazine