
CAS 1316218-10-6
:4-Chloro-2-methyl-6-[1-(methylsulfonyl)-3-piperidinyl]pyrimidine
Description:
4-Chloro-2-methyl-6-[1-(methylsulfonyl)-3-piperidinyl]pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 4-position and a methyl group at the 2-position contributes to its unique reactivity and solubility properties. The compound also features a piperidine ring substituted with a methylsulfonyl group, which enhances its pharmacological potential. This structure suggests that it may exhibit biological activity, possibly as a pharmaceutical agent, due to the presence of both the piperidine and sulfonyl functionalities. The compound is likely to be polar, affecting its solubility in various solvents, and may participate in hydrogen bonding due to the nitrogen and sulfur atoms. Its specific applications and effects would depend on further studies, including its interaction with biological targets and its overall pharmacokinetic profile. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H16ClN3O2S
InChI:InChI=1S/C11H16ClN3O2S/c1-8-13-10(6-11(12)14-8)9-4-3-5-15(7-9)18(2,16)17/h6,9H,3-5,7H2,1-2H3
InChI key:InChIKey=UBENCTHKBNUYLT-UHFFFAOYSA-N
SMILES:ClC1=CC(=NC(C)=N1)C2CN(S(C)(=O)=O)CCC2
Synonyms:- 4-Chloro-2-methyl-6-[1-(methylsulfonyl)-3-piperidinyl]pyrimidine
- Pyrimidine, 4-chloro-2-methyl-6-[1-(methylsulfonyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.