
CAS 1316218-56-0
:4-Chloro-6-[2-[1-(1-methylethyl)-2-piperidinyl]ethyl]pyrimidine
Description:
4-Chloro-6-[2-[1-(1-methylethyl)-2-piperidinyl]ethyl]pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position contributes to its reactivity and potential biological activity. The compound features a side chain that includes a piperidine ring, which is a saturated six-membered ring containing one nitrogen atom, and is substituted with an isopropyl group. This structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's properties, such as solubility, stability, and interaction with biological systems, would be influenced by its functional groups and overall molecular structure. Additionally, its CAS number, 1316218-56-0, allows for precise identification and retrieval of information regarding its synthesis, safety data, and potential uses in research and industry.
Formula:C14H22ClN3
InChI:InChI=1S/C14H22ClN3/c1-11(2)18-8-4-3-5-13(18)7-6-12-9-14(15)17-10-16-12/h9-11,13H,3-8H2,1-2H3
InChI key:InChIKey=TUQOUPSNQYLMEA-UHFFFAOYSA-N
SMILES:C(CC=1C=C(Cl)N=CN1)C2N(C(C)C)CCCC2
Synonyms:- 4-Chloro-6-[2-[1-(1-methylethyl)-2-piperidinyl]ethyl]pyrimidine
- Pyrimidine, 4-chloro-6-[2-[1-(1-methylethyl)-2-piperidinyl]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.