CymitQuimica logo

CAS 1316220-59-3

:

1-[4-(4-Chloro-6-methyl-2-pyrimidinyl)-1-piperidinyl]-2-methoxyethanone

Description:
1-[4-(4-Chloro-6-methyl-2-pyrimidinyl)-1-piperidinyl]-2-methoxyethanone, identified by its CAS number 1316220-59-3, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring, a piperidine moiety, and a methoxyethanone functional group. This compound typically exhibits properties associated with its heterocyclic components, such as potential biological activity, making it of interest in pharmaceutical research. The presence of the chloro and methyl substituents on the pyrimidine ring can influence its reactivity and interaction with biological targets. Additionally, the methoxy group may enhance solubility and stability. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, depending on the conditions. Its specific applications and behavior in biological systems would require further investigation through experimental studies, including pharmacological assays and toxicity evaluations, to fully understand its potential uses and safety profile.
Formula:C13H18ClN3O2
InChI:InChI=1S/C13H18ClN3O2/c1-9-7-11(14)16-13(15-9)10-3-5-17(6-4-10)12(18)8-19-2/h7,10H,3-6,8H2,1-2H3
InChI key:InChIKey=LYNJUHHIPNQWCY-UHFFFAOYSA-N
SMILES:CC1=NC(=NC(Cl)=C1)C2CCN(C(COC)=O)CC2
Synonyms:
  • 1-[4-(4-Chloro-6-methyl-2-pyrimidinyl)-1-piperidinyl]-2-methoxyethanone
  • Ethanone, 1-[4-(4-chloro-6-methyl-2-pyrimidinyl)-1-piperidinyl]-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.