CAS 1316221-41-6
:1-[2-(6-Bromo-2-pyridinyl)-4-morpholinyl]ethanone
Description:
1-[2-(6-Bromo-2-pyridinyl)-4-morpholinyl]ethanone, with the CAS number 1316221-41-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a morpholine group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity due to the presence of the pyridine moiety. The morpholine group contributes to its solubility in polar solvents and may influence its pharmacological properties. The ethanone functional group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the presence of the bromine atom can enhance the compound's reactivity and may serve as a site for further functionalization. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise information.
Formula:C11H13BrN2O2
InChI:InChI=1S/C11H13BrN2O2/c1-8(15)14-5-6-16-10(7-14)9-3-2-4-11(12)13-9/h2-4,10H,5-7H2,1H3
InChI key:InChIKey=FZONIGROQZEXBZ-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CC(OCC1)C=2N=C(Br)C=CC2
Synonyms:- Ethanone, 1-[2-(6-bromo-2-pyridinyl)-4-morpholinyl]-
- 1-[2-(6-Bromo-2-pyridinyl)-4-morpholinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.