
CAS 1316221-65-4
:2-Chloro-3-[1-(methylsulfonyl)-3-piperidinyl]pyrazine
Description:
2-Chloro-3-[1-(methylsulfonyl)-3-piperidinyl]pyrazine is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a chlorine atom and a piperidine moiety containing a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the sulfonyl group that enhances its polarity. The chlorine atom introduces electrophilic characteristics, making it reactive in various chemical reactions. The piperidine ring contributes to the compound's potential biological activity, as piperidine derivatives are often found in pharmaceuticals. Additionally, the presence of the methylsulfonyl group may enhance the compound's pharmacokinetic properties, such as stability and bioavailability. Overall, 2-Chloro-3-[1-(methylsulfonyl)-3-piperidinyl]pyrazine is of interest in medicinal chemistry and may have applications in drug development, particularly in the context of targeting specific biological pathways or receptors.
Formula:C10H14ClN3O2S
InChI:InChI=1S/C10H14ClN3O2S/c1-17(15,16)14-6-2-3-8(7-14)9-10(11)13-5-4-12-9/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=OOBSMECZUMLXPN-UHFFFAOYSA-N
SMILES:ClC=1C(C2CN(S(C)(=O)=O)CCC2)=NC=CN1
Synonyms:- 2-Chloro-3-[1-(methylsulfonyl)-3-piperidinyl]pyrazine
- Pyrazine, 2-chloro-3-[1-(methylsulfonyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.