CymitQuimica logo

CAS 1316223-16-1

:

3-(2-Piperazinyl)benzamide

Description:
3-(2-Piperazinyl)benzamide is a chemical compound characterized by its structural features, which include a benzamide moiety substituted with a piperazine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the piperazine nitrogen atoms. The piperazine ring contributes to its basicity and may enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound may also display various functional properties, such as the ability to form hydrogen bonds, which can influence its reactivity and binding affinity in biological systems. Additionally, the presence of the benzamide group suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. Overall, 3-(2-Piperazinyl)benzamide is a versatile compound with implications in both synthetic and medicinal chemistry, warranting further investigation into its biological activity and potential therapeutic uses.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c12-11(15)9-3-1-2-8(6-9)10-7-13-4-5-14-10/h1-3,6,10,13-14H,4-5,7H2,(H2,12,15)
InChI key:InChIKey=GBOUMKZMZNOCTI-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=C(C=CC1)C2CNCCN2
Synonyms:
  • Benzamide, 3-(2-piperazinyl)-
  • 3-(2-Piperazinyl)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.