
CAS 1316223-48-9
:4-Chloro-6-methyl-2-(1-methyl-3-piperidinyl)pyrimidine
Description:
4-Chloro-6-methyl-2-(1-methyl-3-piperidinyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position contributes to its unique reactivity and potential biological activity. The compound also features a 1-methyl-3-piperidinyl substituent at the 2-position, which enhances its lipophilicity and may influence its pharmacological properties. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's properties, such as solubility, stability, and interaction with biological targets, would be influenced by its functional groups and overall molecular architecture. As with many heterocyclic compounds, it may exhibit interesting biological activities, making it a candidate for further research in drug discovery and development.
Formula:C11H16ClN3
InChI:InChI=1S/C11H16ClN3/c1-8-6-10(12)14-11(13-8)9-4-3-5-15(2)7-9/h6,9H,3-5,7H2,1-2H3
InChI key:InChIKey=GERJVYMNXZRQFV-UHFFFAOYSA-N
SMILES:CC1=NC(=NC(Cl)=C1)C2CN(C)CCC2
Synonyms:- Pyrimidine, 4-chloro-6-methyl-2-(1-methyl-3-piperidinyl)-
- 4-Chloro-6-methyl-2-(1-methyl-3-piperidinyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.