CAS 131631-89-5
:N-[3-[4-[[4-(3,4-Dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]acetamide
Description:
N-[3-[4-[[4-(3,4-Dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]acetamide, with the CAS number 131631-89-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety, a piperidine ring, and an acetamide functional group. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its structural features that may exhibit biological activity. The presence of the quinoline structure suggests potential interactions with biological targets, possibly related to its role in medicinal chemistry. The compound is likely to be soluble in organic solvents and may exhibit moderate to low solubility in water, depending on its specific functional groups. Its molecular weight, polarity, and reactivity can influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). As with many compounds of this nature, safety and toxicity profiles would need to be evaluated through appropriate studies to determine its suitability for therapeutic applications.
Formula:C26H31N3O4
InChI:InChI=1S/C26H31N3O4/c1-19(30)27-15-4-18-33-23-10-7-21(8-11-23)26(32)28-16-13-22(14-17-28)29-24-6-3-2-5-20(24)9-12-25(29)31/h2-3,5-8,10-11,22H,4,9,12-18H2,1H3,(H,27,30)
InChI key:InChIKey=KSNUCNRMDYJBKT-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(CC1)=CC=CC2)C3CCN(C(=O)C4=CC=C(OCCCNC(C)=O)C=C4)CC3
Synonyms:- Acetamide, N-[3-[4-[[4-(3,4-dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]-
- N-[3-(4-{[4-(2-oxo-3,4-dihydroquinolin-1(2H)-yl)piperidin-1-yl]carbonyl}phenoxy)propyl]acetamide
- N-[3-[4-[4-(2-Oxo-1,2,3,4-tetrahydro-1-quinolinyl)piperidin-1-ylcarbonyl]phenoxy]propyl]acetamide
- N-[3-[4-[[4-(3,4-Dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]acetamide
- Opc-21268
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetamide, N-[3-[4-[[4-(3,4-dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]-
CAS:Formula:C26H31N3O4Purity:98%Molecular weight:449.5420Fuscoside
CAS:Fuscoside (OPC-21268) is a non-peptide arginine vasopressin (AVP) receptor VI antagonist with an IC50 value of 0.4 μM.Cost-effective and quality-assured.Formula:C26H31N3O4Purity:98.13% - 99.66%Color and Shape:SolidMolecular weight:449.54OPC 21268
CAS:Controlled ProductOPC 21268 is a drug used to treat chronic congestive heart failure. The drug works by increasing the concentration of cytosolic Ca2+ in cardiac myocytes, which leads to increased contractility and vasopressin secretion. OPC 21268 has been shown to be effective in experimental models of congestive heart failure. OPC 21268 causes vasoconstriction in the renal medulla, thereby increasing the glomerular filtration rate and reducing edema. This drug also has an effect on gland cells, leading to an increase in transcription-polymerase chain reaction activity and cellular proliferation.
Formula:C26H31N3O4Purity:Min. 95%Molecular weight:449.54 g/molRef: 3D-GFA63189
Discontinued product



