
CAS 131635-07-9
:Guanosine, 8-amino-5′-deoxy-5′-iodo-
Description:
Guanosine, 8-amino-5′-deoxy-5′-iodo- is a modified nucleoside that features a guanine base linked to a ribose sugar, with specific substitutions that enhance its biochemical properties. The presence of an amino group at the 8-position and an iodine atom at the 5′ position distinguishes it from standard guanosine. This compound is of interest in biochemical research and pharmaceutical applications due to its potential role in nucleic acid interactions and its influence on biological processes. It may exhibit unique binding affinities and stability compared to unmodified nucleosides, making it a valuable tool in studies involving RNA and DNA. The iodine substitution can also affect the compound's spectroscopic properties, which can be useful in analytical chemistry. Additionally, the structural modifications may impact its metabolic pathways and biological activity, warranting further investigation into its pharmacological potential and therapeutic applications. Overall, Guanosine, 8-amino-5′-deoxy-5′-iodo- represents a significant area of interest in the field of medicinal chemistry and molecular biology.
Formula:C10H13IN6O4
InChI:InChI=1S/C10H13IN6O4/c11-1-2-4(18)5(19)8(21-2)17-6-3(14-10(17)13)7(20)16-9(12)15-6/h2,4-5,8,18-19H,1H2,(H2,13,14)(H3,12,15,16,20)/t2-,4-,5-,8-/m1/s1
InChI key:InChIKey=DLCSQZWDPJIZMH-UMMCILCDSA-N
SMILES:NC=1N(C2=C(N1)C(=O)N=C(N)N2)[C@@H]3O[C@H](CI)[C@@H](O)[C@H]3O
Synonyms:- Guanosine, 8-amino-5′-deoxy-5′-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
