CAS 13164-03-9
:3-(alpha,alpha-dimethylallyl)psoralen
Description:
3-(Alpha,alpha-dimethylallyl)psoralen, with the CAS number 13164-03-9, is a naturally occurring compound belonging to the class of furanocoumarins. It is derived from plants, particularly those in the Apiaceae family, and is known for its phototoxic properties, which can lead to skin reactions upon exposure to ultraviolet light. This compound features a psoralen core structure, characterized by a fused furan and coumarin ring, with an alpha,alpha-dimethylallyl substituent that enhances its biological activity. 3-(Alpha,alpha-dimethylallyl)psoralen exhibits potential therapeutic applications, particularly in dermatology, where it is used in photochemotherapy for conditions like psoriasis and vitiligo. Its mechanism of action involves the formation of covalent bonds with DNA upon UV irradiation, leading to cellular effects that can promote skin repigmentation. However, its use is accompanied by risks of skin damage and carcinogenicity, necessitating careful handling and application. Overall, this compound exemplifies the intersection of natural products and medicinal chemistry, highlighting both its therapeutic potential and safety considerations.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-4-16(2,3)12-8-11-7-10-5-6-18-13(10)9-14(11)19-15(12)17/h4-9H,1H2,2-3H3
InChI key:InChIKey=FYCCCUNGXGKNJV-UHFFFAOYSA-N
SMILES:C(C=C)(C)(C)C1=CC2=C(C=C3C(=C2)C=CO3)OC1=O
Synonyms:- 3-(α,α-Dimethylallyl)psoralen
- 6-(1,1-Dimethyl-2-propen-1-yl)-7H-furo[3,2-g][1]benzopyran-7-one
- 6-(2-methylbut-3-en-2-yl)-7H-furo[3,2-g]chromen-7-one
- 7H-Furo[3,2-g][1]benzopyran-7-one, 6-(1,1-dimethyl-2-propen-1-yl)-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 6-(1,1-dimethyl-2-propenyl)-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 6-(1,1-dimethylallyl)-
- Chalepensin
- Halepensin
- Xylotenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(α,α-dimethylallyl)psoralen
CAS:Formula:C16H14O3Purity:98.0%Color and Shape:SolidMolecular weight:254.2806Chalepensin
CAS:Chalepensin, a furanocoumarin isolated from Ruta chalepensis L. of the Brassicaceae family, is a selective CYP2A6 inhibitor.Formula:C16H14O3Purity:98%Color and Shape:SolidMolecular weight:254.28Chalepensin
CAS:Chalepensin is a chemical compound which is a furanocoumarin, naturally derived from plant sources, primarily from species within the Rutaceae family. This compound is isolated from the traditional medicinal plant Ruta chalepensis. The mode of action of Chalepensin involves interaction with various biological targets, including enzymes and receptors, leading to its bioactive effects. Studies suggest that Chalepensin may inhibit certain biological pathways, thereby exhibiting potential therapeutic effects.
Formula:C16H14O3Purity:Min. 95%Molecular weight:254.28 g/mol


