CAS 13164-90-4
:[(1aS,8S,8aR,8bS)-8a-hydroxy-6-methoxy-1,5-dimethyl-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl]methyl carbamate
Description:
The chemical substance with the name "[(1aS,8S,8aR,8bS)-8a-hydroxy-6-methoxy-1,5-dimethyl-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl]methyl carbamate" and CAS number 13164-90-4 is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl, methoxy, and carbamate. This compound features a bicyclic framework that incorporates both azirene and pyrroloindole moieties, contributing to its potential biological activity. The presence of stereocenters indicates that it may exhibit chirality, which can influence its interactions in biological systems. Additionally, the dioxo and dimethyl substituents suggest that it may participate in various chemical reactions, potentially making it of interest in medicinal chemistry or pharmacology. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other substances. Overall, this compound exemplifies the complexity often found in natural product derivatives and synthetic organic chemistry.
Formula:C16H19N3O6
InChI:InChI=1/C16H19N3O6/c1-6-11(20)10-9(12(21)13(6)24-3)7(5-25-15(17)22)16(23)14-8(18(14)2)4-19(10)16/h7-8,14,23H,4-5H2,1-3H3,(H2,17,22)/t7-,8+,14+,16-,18?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9-Epimitomycin B
CAS:Controlled Product<p>Applications Used as an intermediate in the formation of mitomycin B (M371895), an antitumor antibiotic that is also used as an antineoplastic.<br>References Kinoshita, S., et al.: J. Med. Chem., 14, 13 (1971); Beijnen, J.H., et al.: Anal. Profiles Drug Subs., 16, 361 (1986),<br></p>Formula:C16H19N3O6Color and Shape:NeatMolecular weight:349.349-Epimitomycin B
CAS:<p>9-Epimitomycin B is a water-soluble, alkoxy-substituted amino compound that is used medicinally. It has antibacterial activity and has been shown to be effective against Gram-positive bacteria such as Staphylococcus aureus, Streptococcus pyogenes, and Enterococcus faecalis. 9-Epimitomycin B inhibits the growth of these bacteria by binding to their ribosomes and inhibiting protein synthesis. The carbon atoms in 9-epimitomycin B are linked to an alkoxy group at one end, which causes it to have a higher affinity for bacterial ribosomes than human ribosomes. 9-Epimitomycin B also binds to mitomycin C, which may be responsible for its antimetabolite properties.</p>Formula:C16H19N3O6Purity:Min. 95%Molecular weight:349.34 g/mol

