CAS 131651-37-1
:Turmeronol A
Description:
Turmeronol A, with the CAS number 131651-37-1, is a natural compound derived from turmeric, specifically from the rhizome of Curcuma longa. It belongs to a class of compounds known as sesquiterpenes, which are characterized by their complex structures and diverse biological activities. Turmeronol A is recognized for its potential anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in both medicinal and nutritional contexts. The compound exhibits a unique chemical structure that contributes to its biological effects, and it is often studied for its role in traditional medicine as well as its potential applications in modern therapeutics. Additionally, Turmeronol A may interact with various biological pathways, influencing cellular processes and contributing to the overall health benefits associated with turmeric consumption. Its stability and solubility characteristics can vary, which may affect its bioavailability and efficacy in different formulations. Overall, Turmeronol A represents a significant area of research within the field of natural products and phytochemistry.
Formula:C15H20O2
InChI:InChI=1S/C15H20O2/c1-10(2)7-14(16)8-12(4)13-6-5-11(3)15(17)9-13/h5-7,9,12,17H,8H2,1-4H3/t12-/m0/s1
InChI key:InChIKey=OSIFVLKZUWRNBN-LBPRGKRZSA-N
SMILES:[C@@H](CC(C=C(C)C)=O)(C)C1=CC(O)=C(C)C=C1
Synonyms:- Turmeronol A
- (6S)-6-(3-Hydroxy-4-methylphenyl)-2-methyl-2-hepten-4-one
- 2-Hepten-4-one, 6-(3-hydroxy-4-methylphenyl)-2-methyl-, (6S)-
- (+)-Turmeronol A
- 2-Hepten-4-one, 6-(3-hydroxy-4-methylphenyl)-2-methyl-, (S)-
- (6S)-2-Methyl-6-(3-hydroxy-4-methylphenyl)-2-hepten-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(6S)-2-Methyl-6-(3-hydroxy-4-methylphenyl)-2-hepten-4-one
CAS:Formula:C15H20O2Purity:98.0%Molecular weight:232.3181Turmeronol A
CAS:Turmeronol A and turmeronol B are inhibitors of soybean lipoxygenase, they inhibited soybean lipoxygenase at the IC50 values of 16 uM and 9 uM, respectively.Formula:C15H20O2Purity:98%Color and Shape:SolidMolecular weight:232.32Turmeronol A
CAS:Turmeronol A is a sesquiterpenoid compound, which is derived from the rhizomes of the turmeric plant, Curcuma longa. As a biologically active component, Turmeronol A plays a critical role in the plant's defense mechanisms and imparts a range of medicinal properties. The mode of action of Turmeronol A involves its potent antioxidant activity, where it effectively scavenges free radicals and reduces oxidative stress. This activity is crucial in protecting cells from damage induced by reactive oxygen species (ROS), thereby maintaining cellular integrity and function.
Formula:C15H20O2Purity:Min. 95%Molecular weight:232.32 g/mol


