CAS 131652-35-2
:8-(1-chloro-2-hydroxy-3-methylbut-3-en-1-yl)-7-methoxy-2H-chromen-2-one
Description:
The chemical substance known as 8-(1-chloro-2-hydroxy-3-methylbut-3-en-1-yl)-7-methoxy-2H-chromen-2-one, with the CAS number 131652-35-2, is a synthetic compound that belongs to the class of flavonoids, specifically a chromenone derivative. This compound features a chromone backbone, which is characterized by a benzopyran structure, and includes various functional groups such as a methoxy group and a chloro-substituted side chain. The presence of the chloro and hydroxy groups contributes to its potential biological activity, which may include antioxidant, anti-inflammatory, or antimicrobial properties. The structural complexity of this molecule suggests that it may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, its unique substituents may influence its solubility, stability, and reactivity, which are critical factors in its application in research and potential therapeutic uses. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H15ClO4
InChI:InChI=1/C15H15ClO4/c1-8(2)14(18)13(16)12-10(19-3)6-4-9-5-7-11(17)20-15(9)12/h4-7,13-14,18H,1H2,2-3H3
SMILES:C=C(C)C(C(c1c(ccc2ccc(=O)oc12)OC)Cl)O
Synonyms:- 8-(1-Chloro-2-hydroxy-3-methyl-3-butenyl)-7-methoxy-2H-1-benzopyran-2-one
- Chloculol
- 8-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin
- 8-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin/Chloculol
- 2H-1-Benzopyran-2-one, 8-(1-chloro-2-hydroxy-3-methyl-3-buten-1-yl)-7-methoxy-
- 8-(1-chloro-2-hydroxy-3-Methyl-but-3-enyl)-7-Methoxy-chroMen-2-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin
CAS:8-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin is a natural product for research related to life sciences.Formula:C15H15ClO4Purity:98%Color and Shape:SolidMolecular weight:294.738-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin
CAS:Formula:C15H15ClO4Purity:95%~99%Molecular weight:294.7318-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin
CAS:8-(1-Chloro-2-hydroxy-3-methylbut-3-enyl)-7-methoxycoumarin is a chemically synthesized derivative of coumarin, which is a class of organic compounds known for their diverse pharmacological properties. This compound is synthesized in the laboratory using a series of reactions involving chloroalkene precursors and methoxylated coumarin structures. The compound's mode of action typically involves interaction with specific biological targets, such as enzymes or receptors, which may lead to modulation of biochemical pathways.Formula:C15H15ClO4Purity:Min. 95%Molecular weight:294.73 g/mol



