CAS 131666-72-3

ethyl 2-[3-(2-amino-2-thioxoethyl)-4-oxo-3,4-dihydrophthalazin-1-yl]acetate

Description:

Ethyl 2-[3-(2-amino-2-thioxoethyl)-4-oxo-3,4-dihydrophthalazin-1-yl]acetate, identified by its CAS number 131666-72-3, is a chemical compound that features a complex structure incorporating both phthalazin and thioxo functional groups. This compound typically exhibits characteristics associated with its functional groups, such as potential reactivity due to the presence of the thioxo moiety, which can participate in nucleophilic reactions. The ethyl acetate group suggests that it may have moderate solubility in organic solvents, while the presence of amino and carbonyl groups indicates potential for hydrogen bonding and interactions with biological systems. Its structure may confer biological activity, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reactants. Overall, this compound represents a unique combination of features that could be explored for various chemical and pharmaceutical applications.

Formula: C₁₄H₁₅N₃O₃S

InChI: InChI=1/C14H15N3O3S/c1-2-20-13(18)7-11-9-5-3-4-6-10(9)14(19)17(16-11)8-12(15)21/h3-6H,2,7-8H2,1H3,(H2,15,21)

SMILES: CCOC(=O)Cc1c2ccccc2c(=O)n(CC(=N)S)n1

Synonyms:

• Ethyl [3-(2-Amino-2-Thioxoethyl)-4-Oxo-3,4-Dihydrophthalazin-1-Yl]Acetate

Ethyl 2-[3-(2-amino-2-thioxoethyl)-4-oxo-3,4-dihydrophthalazin-1-yl]acetate

CAS: 131666-72-3

Ethyl 2-[3-(2-amino-2-thioxoethyl)-4-oxo-3,4-dihydrophthalazin-1-yl]acetate

Purity: ≥95%

Molecular weight: 305.35g/mol

Ref: 54-OR25555