
CAS 131671-78-8
:1-Hexanaminium, N-[2-(2-hydroxyethoxy)ethyl]-N,N-dimethyl-, chloride (1:1)
Description:
1-Hexanaminium, N-[2-(2-hydroxyethoxy)ethyl]-N,N-dimethyl-, chloride (1:1), commonly referred to as a quaternary ammonium compound, exhibits characteristics typical of cationic surfactants. This substance features a long hydrophobic hexyl chain, which contributes to its surfactant properties, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of the hydroxyethoxy group enhances its solubility in water and provides potential for hydrogen bonding, which can improve its stability in aqueous solutions. As a quaternary ammonium salt, it is likely to possess antimicrobial properties, making it useful in various applications, including disinfectants and preservatives. Additionally, its cationic nature allows it to interact with negatively charged surfaces, which can be beneficial in formulations for personal care products or industrial applications. However, the specific behavior and efficacy of this compound can vary based on concentration, pH, and the presence of other ingredients in a formulation. Safety data should be consulted to understand its handling and potential environmental impact.
Formula:C12H28NO2·Cl
InChI:InChI=1S/C12H28NO2.ClH/c1-4-5-6-7-8-13(2,3)9-11-15-12-10-14;/h14H,4-12H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=XZVAXVBQWJPKOG-UHFFFAOYSA-M
SMILES:C([N+](CCOCCO)(C)C)CCCCC.[Cl-]
Synonyms:- 1-Hexanaminium, N-[2-(2-hydroxyethoxy)ethyl]-N,N-dimethyl-, chloride (1:1)
- 1-Hexanaminium, N-[2-(2-hydroxyethoxy)ethyl]-N,N-dimethyl-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Hexanaminium, N-[2-(2-hydroxyethoxy)ethyl]-N,N-dimethyl-, chloride (1:1)
CAS:Formula:C12H28ClNO2Molecular weight:253.8092
