CAS 131674-40-3

1-(2-Methoxy-3-pyridinyl)ethanone

Description:

1-(2-Methoxy-3-pyridinyl)ethanone, with the CAS number 131674-40-3, is an organic compound characterized by its pyridine ring and an ethanone functional group. This substance features a methoxy group attached to the pyridine, which contributes to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both the aromatic pyridine and the carbonyl group in the ethanone structure. The methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction environment. Overall, 1-(2-Methoxy-3-pyridinyl)ethanone is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₈H₉NO₂

InChI: InChI=1S/C8H9NO2/c1-6(10)7-4-3-5-9-8(7)11-2/h3-5H,1-2H3

InChI key: InChIKey=JOYKURWXKUIHDB-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(C)=O)C=CC=N1

Synonyms:

• 1-(2-Methoxy-3-pyridinyl)ethanone
• 1-(2-Methoxypyridin-3-Yl)Ethanone
• 1-(2-Methoxypyridin-3-yl)ethan-1-one
• 3-Acetyl-2-methoxypyridine
• Ethanone, 1-(2-methoxy-3-pyridinyl)-

Ethanone, 1-(2-methoxy-3-pyridinyl)-

CAS: 131674-40-3

Formula: C₈H₉NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 151.1626

Ref: IN-DA000ZJY

1-(2-Methoxypyridin-3-yl)ethanone

CAS: 131674-40-3

1-(2-Methoxypyridin-3-yl)ethanone

Purity: 98%

Molecular weight: 151.16255g/mol

Ref: 54-OR302200

3-Acetyl-2-methoxypyridine

CAS: 131674-40-3

Purity: 98%

Molecular weight: 151.163

Ref: FT-Y14961

1-(2-Methoxypyridin-3-yl)ethanone

CAS: 131674-40-3

Formula: C₈H₉NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 151.165

Ref: 10-F238259

1-(2-Methoxypyridin-3-yl)ethanone

CAS: 131674-40-3

1-(2-Methoxypyridin-3-yl)ethanone is a structural analog of 2-chloropyridine. It has the same stereochemistry as 2-chloropyridine and can be synthesized from it by metallation, oxidation, or acridone synthesis. 1-(2-Methoxypyridin-3-yl)ethanone can be used as an intermediate in the synthesis of coumarins and acridones. It is also used to produce enantiomerically pure (S)-1-(2-methoxypyridin-3-yl)propanol. The optical activity of this compound was determined using a polarimeter.

Formula: C₈H₉NO₂

Purity: Min. 95%

Molecular weight: 151.16 g/mol

Ref: 3D-GFA67440