CAS 13168-11-1
:Glucuronic acid 1-phosphate
Description:
Glucuronic acid 1-phosphate is a biochemical compound that plays a significant role in various metabolic processes, particularly in the context of carbohydrate metabolism and detoxification. It is a phosphorylated derivative of glucuronic acid, which is a uronic acid formed from glucose. This compound is characterized by the presence of a phosphate group attached to the first carbon of the glucuronic acid molecule, which enhances its reactivity and solubility in biological systems. Glucuronic acid itself is known for its role in conjugation reactions, where it helps in the detoxification of drugs and xenobiotics by facilitating their excretion. The phosphate group in glucuronic acid 1-phosphate can participate in various biochemical pathways, including those involved in energy metabolism and the synthesis of glycosaminoglycans. Its presence in cellular metabolism underscores its importance in maintaining homeostasis and supporting various physiological functions. As a biochemical entity, glucuronic acid 1-phosphate is essential for understanding metabolic pathways and the biochemical basis of detoxification processes in living organisms.
Formula:C6H11O10P
InChI:InChI=1S/C6H11O10P/c7-1-2(8)4(5(10)11)15-6(3(1)9)16-17(12,13)14/h1-4,6-9H,(H,10,11)(H2,12,13,14)/t1-,2-,3+,4-,6+/m0/s1
InChI key:InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-N
SMILES:O(P(=O)(O)O)[C@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- Glucuronic acid 1-phosphate
- α-D-Glucuronic acid 1-phosphate
- Glucuronic acid, 1-phosphate, α-D-
- Glucopyranuronic acid, 1-(dihydrogen phosphate), α-D-
- α-D-Glucopyranuronic acid, 1-(dihydrogen phosphate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
a-D-Glucuronic acid-1-phosphate
CAS:a-D-Glucuronic acid-1-phosphate is a substrate for alkaline phosphatase. It hydrolyzes phosphate esters and modifies inorganic phosphate, including pyrophosphate. It also catalyzes the hydrolysis of nucleotide monophosphates such as NADPH and UDPglucose to their respective diphosphates. This enzyme is not inhibited by inorganic phosphate, phosphatase, NADP+, or UDP-.
Formula:C6H11O10PPurity:Min. 95%Color and Shape:PowderMolecular weight:274.12 g/molα-D-Glucuronic Acid 1-Phosphate
CAS:Controlled ProductFormula:C6H11O10PColor and Shape:NeatMolecular weight:274.119Ref: 4Z-G-067055
Discontinued product



