
CAS 13168-35-9
:4,4′-Cyclohexylidenebis[2,6-dichlorophenol]
Description:
4,4′-Cyclohexylidenebis[2,6-dichlorophenol], with CAS number 13168-35-9, is an organic compound characterized by its unique molecular structure, which features a cyclohexylidene group linked to two 2,6-dichlorophenol moieties. This compound typically exhibits a solid state at room temperature and is known for its stability and resistance to thermal degradation. It is often utilized in various applications, including as a chemical intermediate in the synthesis of polymers and as a potential additive in materials due to its properties. The presence of chlorine atoms in the phenolic rings enhances its reactivity and can influence its solubility in organic solvents. Additionally, the compound may exhibit specific optical properties, making it of interest in fields such as materials science and organic chemistry. Safety data should be consulted for handling and exposure guidelines, as with many chlorinated compounds, it may pose environmental and health risks. Overall, 4,4′-Cyclohexylidenebis[2,6-dichlorophenol] is a notable compound in the realm of synthetic organic chemistry.
Formula:C18H16Cl4O2
InChI:InChI=1S/C18H16Cl4O2/c19-12-6-10(7-13(20)16(12)23)18(4-2-1-3-5-18)11-8-14(21)17(24)15(22)9-11/h6-9,23-24H,1-5H2
InChI key:InChIKey=ANLICCDGDIUHJE-UHFFFAOYSA-N
SMILES:ClC=1C=C(C2(CCCCC2)C3=CC(Cl)=C(O)C(Cl)=C3)C=C(Cl)C1O
Synonyms:- Phenol, 4,4′-cyclohexylidenebis[2,6-dichloro-
- 1,1-Bis(3,5-dichloro-4-hydroxyphenyl)cyclohexane
- NSC 15450
- 4,4′-Cyclohexylidenebis[2,6-dichlorophenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
