CAS 1316857-41-6
:3,5-Dibromo-2,3-dihydro-1H-inden-1-one
Description:
3,5-Dibromo-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes a fused indene and carbonyl group. This compound features two bromine atoms substituted at the 3 and 5 positions of the indene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl group (ketone) enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic additions and cycloadditions. The dibromo substitution can also influence the compound's physical properties, such as solubility and melting point, as well as its reactivity in halogenation and coupling reactions. Additionally, the compound may exhibit interesting biological activities, which could be explored for pharmaceutical applications. Its synthesis typically involves bromination of the indene derivative followed by appropriate functional group transformations. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and disposal.
Formula:C9H6Br2O
InChI:InChI=1S/C9H6Br2O/c10-5-1-2-6-7(3-5)8(11)4-9(6)12/h1-3,8H,4H2
InChI key:InChIKey=OLNNZDYJEWDYSL-UHFFFAOYSA-N
SMILES:BrC1C=2C(C(=O)C1)=CC=C(Br)C2
Synonyms:- 3,5-Dibromo-2,3-dihydro-1H-inden-1-one
- 1H-Inden-1-one, 3,5-dibromo-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
