
CAS 131690-66-9
:1,6-Dioxa-5-germaspiro[4.4]nonane-2,7-dione
Description:
1,6-Dioxa-5-germaspiro[4.4]nonane-2,7-dione is a chemical compound characterized by its unique spirocyclic structure, which incorporates both germanium and oxygen atoms. The presence of the dione functional groups indicates that the compound contains two carbonyl (C=O) groups, contributing to its reactivity and potential applications in organic synthesis. The spirocyclic framework suggests that the compound may exhibit interesting stereochemical properties and conformational flexibility. Additionally, the germanium atom in the structure can impart distinct electronic properties, making it of interest in materials science and coordination chemistry. The compound's solubility, stability, and reactivity can vary significantly depending on the surrounding environment and the presence of other functional groups. Overall, 1,6-Dioxa-5-germaspiro[4.4]nonane-2,7-dione represents a fascinating example of organometallic chemistry, with potential implications in various fields, including catalysis and the development of novel materials.
Formula:C6H8GeO4
InChI:InChI=1S/C6H8GeO4/c8-5-1-3-7(10-5)4-2-6(9)11-7/h1-4H2
InChI key:InChIKey=MMHJBARKBVTQKV-UHFFFAOYSA-N
SMILES:O=C1O[Ge]2(OC(=O)CC2)CC1
Synonyms:- 1,6-Dioxa-5-germaspiro[4.4]nonane-2,7-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
