CAS 13171-93-2
:N-cbz-gly-gly-phe
Description:
N-Cbz-gly-gly-phe, also known as N-carbobenzyloxy-glycyl-glycyl-phenylalanine, is a peptide derivative characterized by its structure, which includes the amino acids glycine (Gly) and phenylalanine (Phe) with a carbobenzyloxy (Cbz) protecting group. This compound is typically used in peptide synthesis and research due to its ability to serve as a building block for more complex peptides. The Cbz group provides protection for the amino group, allowing for selective reactions without interfering with the peptide bond formation. N-Cbz-gly-gly-phe is generally soluble in organic solvents and exhibits stability under standard laboratory conditions. Its properties make it valuable in the fields of medicinal chemistry and biochemistry, particularly in the development of peptide-based drugs and in studying peptide interactions. As with many peptides, its biological activity and interactions can be influenced by the specific sequence and modifications present, making it a subject of interest for further research in peptide chemistry.
Formula:C21H23N3O6
InChI:InChI=1/C21H23N3O6/c25-18(12-23-21(29)30-14-16-9-5-2-6-10-16)22-13-19(26)24-17(20(27)28)11-15-7-3-1-4-8-15/h1-10,17H,11-14H2,(H,22,25)(H,23,29)(H,24,26)(H,27,28)
SMILES:c1ccc(cc1)CC(C(=O)O)N=C(CN=C(CN=C(O)OCc1ccccc1)O)O
Synonyms:- Z-Gly-Gly-Phe-OH
- N-[(benzyloxy)carbonyl]glycylglycylphenylalanine
- N-cbz-gly-gly-phe
- N-(Benzyloxycarbonyl)glycylglycyl-L-phenylalanine
- N-carbobenzyloxy-Gly-Gly-Phe
- (S)-11-Benzyl-3,6,9-trioxo-1-phenyl-2-oxa-4,7,10-triazadodecan-12-oic acid
- L-Phenylalanine, N-[(phenylmethoxy)carbonyl]glycylglycyl-
- N-Cbz-glycyl-glycyl-L-phenylalanine
- (2S)-2-[2-(2-{[(benzyloxy)carbonyl]amino}acetamido)acetamido]-3-phenylpropanoic acid
- ((benzyloxy)carbonyl)glycylglycyl-L-phenylalanine
- Z-GLYCYL-GLYCYL-L-PHENYLALANINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Z-Gly-Gly-Phe-OH
CAS:Bachem ID: 4010787.
Formula:C21H23N3O6Purity:99.50%Color and Shape:White PowderMolecular weight:413.43Z-Gly-Gly-Phe-OH
CAS:Z-Gly-Gly-Phe-OH is a sweetener that is used in the food and beverage industry. It is also used in the manufacture of peptides for therapeutic purposes. Z-Gly-Gly-Phe-OH has been shown to be effective as an inhibitor of carboxyl esterases, which are enzymes that break down fatty acids. This inhibition leads to a delayed absorption of fats and oils. Z-Gly-Gly-Phe-OH can be synthesized by chemical methods or enzymatic methods. The former method involves the reaction between 3,4,5,6 tetrahydropyran with glyoxylic acid and glycine. The latter method involves esterification of glycine with 3,4,5,6 tetrahydropyran followed by hydrolysis of the resulting dicyclohexylurea to yield Z-glycidol and Phe.
Formula:C21H23N3O6Purity:Min. 95%Color and Shape:PowderMolecular weight:413.42 g/mol




