CAS 131724-45-3: 4-Cyano-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine
Description:4-Cyano-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine, with the CAS number 131724-45-3, is an amino acid derivative characterized by the presence of a cyano group and a tert-butoxycarbonyl (Boc) protecting group. This compound features a phenylalanine backbone, which is an essential amino acid known for its role in protein synthesis and as a precursor for neurotransmitters. The cyano group introduces a polar functional group that can enhance solubility in certain solvents and may participate in various chemical reactions, such as nucleophilic additions. The Boc group serves as a protective moiety, commonly used in peptide synthesis to prevent unwanted reactions at the amino group. This compound is typically utilized in organic synthesis and pharmaceutical research, particularly in the development of peptide-based drugs. Its stability, reactivity, and functional groups make it a valuable intermediate in the synthesis of more complex molecules. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity and reactivity.
Formula:C15H18N2O4
InChI:InChI=1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m0/s1
InChI key:InChIKey=RMBLTLXJGNILPG-LBPRGKRZSA-N
SMILES:N#CC1=CC=C(C=C1)CC(NC(=O)OC(C)(C)C)C(=O)O
- Synonyms:
- (2S)-2-(tert-Butoxycarbonylamino)-3-(4-cyanophenyl)propanoic acid
- (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(4-cyanophenyl)propionic acid
- (2S)-2-[(tert-butoxycarbonyl)amino]-3-(4-cyanophenyl)propanoate
- (2S)-3-(4-Cyanophenyl)-2-(tert-butoxycarbonylamino)propanoic acid
- (S)-2-[(tert-Butoxycarbonyl)amino]-3-(4-cyanophenyl)propanoic acid
- (S)-2-[(tert-Butoxycarbonyl)amino]-3-(4-cyanophenyl)propionic acid
- 4-Cyano-N-[(1,1-dimethylethoxy)carbonyl]-<span class="text-smallcaps">L</span>-phenylalanine
- <span class="text-smallcaps">L</span>-Phenylalanine, 4-cyano-N-[(1,1-dimethylethoxy)carbonyl]-
- Boc-4-Cyano-L-phenylalanine
- Boc-L-4-Cyanophe
- See more synonyms
- Boc-L-4-Cyanophenylalanine
- Boc-L-Phe(4-Cn)
- Boc-L-Phe(4-Cn)-Oh
- Boc-P-Cyano-L-Phe-Oh
- Boc-P-Cyano-L-Phenylalanine
- Boc-Phe(4-Cn)-Oh
- Boc-Phe(P-Cn)-Oh
- N-(tert-butoxycarbonyl)-4-cyano-D-phenylalanine
- N-(tert-butoxycarbonyl)-4-cyano-L-phenylalanine
- 4-Cyano-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine
- L-Phenylalanine, 4-cyano-N-[(1,1-dimethylethoxy)carbonyl]-