CymitQuimica logo

CAS 131727-29-2

:

DIETHYL 1-(2-BROMO-ETHYL)-1H-PYRAZOLE-3,5-DICARBOXYLIC ACID

Description:
Diethyl 1-(2-bromo-ethyl)-1H-pyrazole-3,5-dicarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring substituted with a bromoethyl group and two carboxylic acid functionalities. This compound typically appears as a solid and is soluble in polar organic solvents. The presence of the bromoethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The carboxylic acid groups contribute to its acidity and can participate in various chemical reactions, including esterification and amidation. This compound may be of interest in medicinal chemistry and agricultural applications due to its potential biological activity. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as the bromine atom can impart toxicity and environmental concerns. As with any chemical, proper laboratory practices should be followed to ensure safe usage.
Formula:C11H15BrN2O4
InChI:InChI=1/C11H15BrN2O4/c1-3-17-10(15)8-7-9(11(16)18-4-2)14(13-8)6-5-12/h7H,3-6H2,1-2H3
SMILES:CCOC(=O)c1cc(C(=O)OCC)n(CCBr)n1
Synonyms:
  • 1H-pyrazole-3,5-dicarboxylic acid, 1-(2-bromoethyl)-, diethyl ester
  • Diethyl 1-(2-bromoethyl)-1H-pyrazole-3,5-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.