CAS 13173-22-3
:2-Methyl-1-(2-propen-1-yl)-1H-imidazole
Description:
2-Methyl-1-(2-propen-1-yl)-1H-imidazole, with the CAS number 13173-22-3, is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group and a propenyl group attached to the imidazole ring, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the propenyl group suggests that it may participate in various chemical reactions, including polymerization and addition reactions, making it useful in synthetic organic chemistry. Its solubility in organic solvents and moderate volatility are notable characteristics, which may influence its applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the compound's structure may impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-3-5-9-6-4-8-7(9)2/h3-4,6H,1,5H2,2H3
InChI key:InChIKey=SUILEBXRIVKHGT-UHFFFAOYSA-N
SMILES:C(C=C)N1C(C)=NC=C1
Synonyms:- 1-Allyl-2-methylimidazole
- Imidazole, 1-allyl-2-methyl-
- 2-Methyl-1-(2-propen-1-yl)-1H-imidazole
- 1H-Imidazole, 2-methyl-1-(2-propen-1-yl)-
- 1H-Imidazole, 2-methyl-1-(2-propenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
