CAS 131736-83-9
:1-fluorohomocitrate
Description:
1-Fluorohomocitrate is a chemical compound characterized by the presence of a fluorine atom attached to a homocitrate structure. Homocitrate itself is a derivative of citric acid, featuring a carboxyl group and hydroxyl groups that contribute to its reactivity and solubility in water. The introduction of a fluorine atom can significantly influence the compound's chemical properties, such as its acidity, reactivity, and potential biological activity. Fluorinated compounds often exhibit enhanced lipophilicity and altered metabolic pathways compared to their non-fluorinated counterparts. 1-Fluorohomocitrate may be of interest in biochemical research, particularly in studies related to metabolic processes or enzyme interactions, given its structural similarity to citric acid, a key player in the Krebs cycle. However, specific applications, stability, and toxicity profiles would require further investigation through empirical studies. As with many fluorinated compounds, safety precautions should be taken when handling due to potential health risks associated with fluorine.
Formula:C7H9FO7
InChI:InChI=1/C7H9FO7/c8-4(5(11)12)7(15,6(13)14)2-1-3(9)10/h4,15H,1-2H2,(H,9,10)(H,11,12)(H,13,14)
SMILES:C(CC(C(C(=O)O)F)(C(=O)O)O)C(=O)O
Synonyms:- 1,2,4-Butanetricarboxylic acid, 1-fluoro-2-hydroxy-
- 1-Fluoro-2-Hydroxybutane-1,2,4-Tricarboxylic Acid
- 1-Fluorohomocitrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
