
CAS 131739-14-5
:4′-[2-(4-Chlorophenyl)ethyl]-4-ethyl-2-fluoro-1,1′-biphenyl
Description:
4′-[2-(4-Chlorophenyl)ethyl]-4-ethyl-2-fluoro-1,1′-biphenyl, with CAS number 131739-14-5, is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a 4-chlorophenyl group and an ethyl group attached to the biphenyl backbone, as well as a fluorine atom at the 2-position of one of the phenyl rings. The presence of the chlorine and fluorine substituents contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The compound may exhibit specific biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could interact with various biological targets, and its halogenated nature may influence its lipophilicity and metabolic stability. Overall, this compound's distinctive features make it a subject of interest in both synthetic chemistry and medicinal chemistry applications.
Formula:C22H20ClF
InChI:InChI=1S/C22H20ClF/c1-2-16-9-14-21(22(24)15-16)19-10-5-17(6-11-19)3-4-18-7-12-20(23)13-8-18/h5-15H,2-4H2,1H3
InChI key:InChIKey=ZZXBIOGVVXZNFO-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC=C(CCC3=CC=C(Cl)C=C3)C=C2)C=CC(CC)=C1
Synonyms:- 1,1′-Biphenyl, 4′-[2-(4-chlorophenyl)ethyl]-4-ethyl-2-fluoro-
- 4′-[2-(4-Chlorophenyl)ethyl]-4-ethyl-2-fluoro-1,1′-biphenyl
- FET-2Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1'-Biphenyl, 4'-[2-(4-chlorophenyl)ethyl]-4-ethyl-2-fluoro-
CAS:Formula:C22H20ClFMolecular weight:338.8456
