CAS 13174-24-8
:BENZYL-(3,4-DIMETHOXY-BENZYL)-AMINE
Description:
Benzyl-(3,4-dimethoxy-benzyl)-amine, with the CAS number 13174-24-8, is an organic compound characterized by its amine functional group and the presence of methoxy substituents on the aromatic ring. This compound features a benzyl group attached to a 3,4-dimethoxybenzyl moiety, which contributes to its structural complexity and potential reactivity. The methoxy groups enhance the electron density on the aromatic ring, influencing its chemical behavior and interactions. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic structures. The presence of the amine group suggests potential basicity and the ability to form hydrogen bonds, which can affect its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, such compounds may possess biological activity, making them of interest in medicinal chemistry and pharmacology. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C16H19NO2
InChI:InChI=1/C16H19NO2/c1-18-15-9-8-14(10-16(15)19-2)12-17-11-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3
SMILES:COc1ccc(cc1OC)CNCc1ccccc1
Synonyms:- Benzenemethanamine, 3,4-dimethoxy-N-(phenylmethyl)-
- N-Benzyl-1-(3,4-dimethoxyphenyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
