
CAS 131747-33-6
:2-Pyridinemethanol, 3-nitro-, 2-acetate
Description:
2-Pyridinemethanol, 3-nitro-, 2-acetate, with the CAS number 131747-33-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and an acetate group (-COOCH3) attached to the pyridine ring, along with a nitro group (-NO2) at the 3-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The nitro group is known for its electron-withdrawing properties, which can influence the compound's acidity and reactivity. Additionally, the acetate moiety can participate in esterification reactions. The compound is likely to be soluble in polar solvents due to the hydroxyl group, while its aromatic nature may provide some degree of hydrophobic character. Overall, 2-Pyridinemethanol, 3-nitro-, 2-acetate exhibits a combination of properties that make it of interest for further chemical research and application development.
Formula:C8H8N2O4
InChI:InChI=1S/C8H8N2O4/c1-6(11)14-5-7-8(10(12)13)3-2-4-9-7/h2-4H,5H2,1H3
InChI key:InChIKey=ZIYJPXZUYGNNFD-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C1=C(N(=O)=O)C=CC=N1
Synonyms:- (3-Nitropyridin-2-yl)methyl acetate
- 2-Pyridinemethanol, 3-nitro-, acetate (ester)
- 2-Pyridinemethanol, 3-nitro-, 2-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.