CAS 131747-41-6
:2-(trifluoromethyl)isonicotinic acid
Description:
2-(Trifluoromethyl)isonicotinic acid is a chemical compound characterized by the presence of a trifluoromethyl group (-CF3) attached to the isonicotinic acid structure. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a carboxylic acid functional group (-COOH) that contributes to its acidity. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms typically increases the compound's stability and can affect its reactivity and interaction with biological targets. This compound is often utilized in research related to pharmaceuticals and agrochemicals due to its unique properties. Additionally, its solubility and behavior in various solvents can be influenced by the functional groups present, making it a subject of study in various chemical applications. Overall, 2-(trifluoromethyl)isonicotinic acid is notable for its structural features and potential applications in diverse fields.
Formula:C7H4F3NO2
InChI:InChI=1/C7H4F3NO2/c8-7(9,10)5-3-4(6(12)13)1-2-11-5/h1-3H,(H,12,13)
SMILES:c1cnc(cc1C(=O)O)C(F)(F)F
Synonyms:- 2-Pyridinecarboxylic acid, 6-(trifluoromethyl)-
- 6-(Trifluoromethyl)-2-pyridinecarboxylic acid
- 6-(Trifluoromethyl)pyridine-2-carboxylic acid
- 6-Trifluoromethylpyridine-2-carboxylic acid
- 2-(Trifluoromethyl)Pyridine-4-Carboxylic Acid
- 2-(trifluoromethyl)-4-Pyridinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(Trifluoromethyl)isonicotinic Acid
CAS:Formula:C7H4F3NO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:191.112-(Trifluoromethyl)pyridine-4-carboxylic acid, 97%
CAS:2-(Trifluoromethyl)pyridine-4-carboxylic acid, is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / i
Formula:C7H4F3NO2Purity:97%Color and Shape:White to brown, Crystals or crystalline powder or powderMolecular weight:191.112-(Trifluoromethyl)isonicotinic acid, 98%
CAS:Formula:C7H4F3NO2Color and Shape:Crystal - PowderMolecular weight:191.112-(Trifluoromethyl)Isonicotinic Acid
CAS:Formula:C7H4F3NO2Purity:98%Color and Shape:SolidMolecular weight:191.1074Ref: IN-DA000ZNB
1g26.00€5g50.00€10g76.00€1kgTo inquire25g139.00€100g515.00€500gTo inquire250mg22.00€2-(Trifluoromethyl)isonicotinic acid
CAS:2-(Trifluoromethyl)isonicotinic acidFormula:C7H4F3NO2Purity:96%Color and Shape: white to off white powderMolecular weight:191.11g/mol2-(Trifluoromethyl)isonicotinic acid
CAS:Formula:C7H4F3NO2Purity:98%Color and Shape:SolidMolecular weight:191.109






