CAS 131747-42-7
:6-Trifluoromethyl-2-pyridinecarboxylic acid
Description:
6-Trifluoromethyl-2-pyridinecarboxylic acid is an aromatic carboxylic acid characterized by the presence of a pyridine ring substituted with a trifluoromethyl group and a carboxylic acid functional group. This compound typically exhibits a polar nature due to the electronegative fluorine atoms, which can influence its solubility in various solvents, often making it more soluble in polar solvents. The trifluoromethyl group enhances the acidity of the carboxylic acid, potentially increasing its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of the pyridine ring may contribute to its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can affect its physical properties, such as melting and boiling points. Overall, 6-Trifluoromethyl-2-pyridinecarboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C7H4F3NO2
InChI:InChI=1S/C7H4F3NO2/c8-7(9,10)5-3-1-2-4(11-5)6(12)13/h1-3H,(H,12,13)
InChI key:InChIKey=OKBHXGBLXDNJJD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C(O)=O)C=CC1
Synonyms:- 2-Pyridinecarboxaldehyde, 3-(Trifluoromethyl)-
- 2-Pyridinecarboxylic acid, 6-(trifluoromethyl)-
- 2-Trifluoromethyl-6-Pyridinecarboxylic Acid
- 3-(Trifluoromethyl)Pyridine-2-Carbaldehyde
- 3-Trifluoromethyl-2-pyridinecarboxaldehyde
- 6-(Trifluoromethyl)-2-pyridinecarboxylic acid
- 6-(trifluoromethyl)pyridine-2-carboxylic acid
- 6-(Trifluoromethyl)picolinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-(Trifluoromethyl)pyridine-2-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4F3NO2Purity:98%Molecular weight:191.116-(Trifluoromethyl)pyridine-2-carboxylic acid
CAS:6-(Trifluoromethyl)pyridine-2-carboxylic acidFormula:C7H4F3NO2Purity:98%Color and Shape:White to yellow Solid-PowderMolecular weight:191.107362-Pyridinecarboxylic acid, 6-(trifluoromethyl)-
CAS:Formula:C7H4F3NO2Purity:98%Color and Shape:SolidMolecular weight:191.1074Ref: IN-DA000ZNA
250mg22.00€1g24.00€5g34.00€10g50.00€25g61.00€50g89.00€100g134.00€250g220.00€500g532.00€6-(Trifluoromethyl)-2-pyridinecarboxylic Acid
CAS:Formula:C7H4F3NO2Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:191.116-(Trifluoromethyl)pyridine-2-carboxylic acid
CAS:Formula:C7H4F3NO2Purity:97%Color and Shape:SolidMolecular weight:191.1096-(Trifluoromethyl)picolinic acid
CAS:6-(Trifluoromethyl)picolinic acidFormula:C7H4F3NO2Purity:98%Molecular weight:191.11






