CAS 131747-47-2

6-Nitro-2-pyridinemethanol

Description:

6-Nitro-2-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a nitro group (-NO2) at the 6-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The hydroxymethyl group (-CH2OH) at the 2-position enhances its solubility in polar solvents and may influence its biological activity. This compound is typically a yellow to orange solid and may exhibit moderate to high stability under standard conditions. Its chemical properties make it a candidate for use in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, the nitro group can participate in electrophilic substitution reactions, while the hydroxymethyl group can serve as a site for further functionalization. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock. Overall, 6-Nitro-2-pyridinemethanol is a versatile compound with potential applications in various fields of chemistry.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c9-4-5-2-1-3-6(7-5)8(10)11/h1-3,9H,4H2

InChI key: InChIKey=LVUBIFMBKHDBRK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N=C(CO)C=CC1

Synonyms:

• 2-Pyridinemethanol, 6-nitro-
• 6-Nitro-2-pyridinemethanol
• (6-Nitropyridin-2-yl)methanol