CAS 131747-63-2

4-BROMOPYRIDINE-2-CARBALDEHYDE

Description:

4-Bromopyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and an aldehyde functional group at the 2-position significantly influences its chemical properties and reactivity. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic pyridine ring. 4-Bromopyridine-2-carbaldehyde is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic addition reactions and other transformations. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to ensure safety and stability, given its potential reactivity and toxicity.

Formula: C₆H₄BrNO

InChI: InChI=1/C6H4BrNO/c7-5-1-2-8-6(3-5)4-9/h1-4H

SMILES: c1cnc(cc1Br)C=O

Synonyms:

• 4-Bromopyridine-2-carboxaldehyde

2-Pyridinecarboxaldehyde, 4-bromo-

CAS: 131747-63-2

Formula: C₆H₄BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.0061

Ref: IN-DA000ZO7

4-Bromopyridine-2-carboxaldehyde

CAS: 131747-63-2

Formula: C₆H₄BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.008

Ref: 10-F077333

4-Bromopyridine-2-carbaldehyde

CAS: 131747-63-2

4-Bromopyridine-2-carbaldehyde

Formula: C₆H₄BrNO

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 186.01g/mol

Ref: 54-OR302555

4-Bromopyridine-2-carboxaldehyde

Controlled Product

CAS: 131747-63-2

Formula: C₆H₄BrNO

Color and Shape: Neat

Molecular weight: 186.01

Ref: TR-B686135