CAS 131748-92-0

2-BROMO-5-AMINOMETHYL-THIAZOLE HYDROCHLORIDE

Description:

2-Bromo-5-aminomethyl-thiazole hydrochloride is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a bromine atom at the 2-position and an aminomethyl group at the 5-position contributes to its reactivity and potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry and research. It may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical development. The molecular structure allows for various functional group interactions, which can be exploited in synthetic pathways or biological assays. As with many thiazole derivatives, it may also participate in nucleophilic substitution reactions due to the presence of the bromine atom. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₄H₆BrClN₂S

InChI: InChI=1S/C4H5BrN2S/c5-4-7-2-3(1-6)8-4/h2H,1,6H2

InChI key: InChIKey=JZLXHPPZGZESTM-UHFFFAOYSA-N

SMILES: C(N)C=1SC(Br)=NC1

5-Thiazolemethanamine, 2-bromo-

CAS: 131748-92-0

Formula: C₄H₅BrN₂S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 193.0649

Ref: IN-DA000ZOQ

(2-Bromothiazol-5-yl)methanamine

CAS: 131748-92-0

(2-Bromothiazol-5-yl)methanamine

Purity: 97%

Molecular weight: 193.06g/mol

Ref: 54-OR92456

(2-Bromothiazol-5-yl)methanamine

CAS: 131748-92-0

Formula: C₄H₅BrN₂S

Purity: 95%

Molecular weight: 193.06

Ref: 10-F338360

(2-bromo-1,3-thiazol-5-yl)methanamine

CAS: 131748-92-0

2-bromo-1,3-thiazol-5-yl)methanamine is a ring system that contains a phthalimide and thiazole. It has a planar molecular geometry. The methoxy group is located on the left side of the molecule, which creates a dihedral angle of about 60°. The two bromine atoms are on opposite sides of the molecule and are separated by 2.6 Å. This ring system reacts readily with nucleophiles to form covalent bonds.

Formula: C₄H₅BrN₂S

Purity: Min. 95%

Molecular weight: 193.1 g/mol

Ref: 3D-GFA74892