CymitQuimica logo

CAS 131748-94-2

:

2-(Difluoromethoxy)-5-methylthiazole

Description:
2-(Difluoromethoxy)-5-methylthiazole is a chemical compound characterized by its unique thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. The presence of a difluoromethoxy group enhances its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate polarity due to the electronegative fluorine atoms and the ether functionality, influencing its solubility in organic solvents. It may also display interesting biological activity, making it a candidate for pharmaceutical research. The thiazole moiety is known for its role in various biological systems and can be involved in interactions with biological targets. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as temperature and pH. Overall, 2-(Difluoromethoxy)-5-methylthiazole is a versatile compound with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.
Formula:C5H5F2NOS
InChI:InChI=1S/C5H5F2NOS/c1-3-2-8-5(10-3)9-4(6)7/h2,4H,1H3
InChI key:InChIKey=YJVQCZAJQGNXJG-UHFFFAOYSA-N
SMILES:O(C(F)F)C=1SC(C)=CN1
Synonyms:
  • 2-(Difluoromethoxy)-5-methyl-1,3-thiazole
  • Thiazole, 2-(difluoromethoxy)-5-methyl-
  • 2-(Difluoromethoxy)-5-methylthiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.