CAS 131749-24-1
:(3S,4S,5S,6R)-3,4,5-trihydroxy-6-[[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3S,4S,5S,6R)-3,4,5-trihydroxy-6-[[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]tetrahydropyran-2-carboxylic acid" and CAS number "131749-24-1" is a complex organic compound characterized by multiple hydroxyl groups and a carboxylic acid functional group, which contribute to its hydrophilicity and potential biological activity. The presence of a tetrahydropyran ring indicates a cyclic structure that may influence its reactivity and interactions with biological systems. Additionally, the compound features a steroid-like backbone, suggesting potential hormonal or therapeutic properties. Its stereochemistry, denoted by the specific configuration at multiple chiral centers, is crucial for its biological function and interaction with receptors. Overall, this compound's intricate structure and functional groups suggest it may play a role in medicinal chemistry, possibly as a lead compound for drug development or as a bioactive molecule in natural products.
Formula:C24H34O8
InChI:InChI=1/C24H34O8/c1-24-9-8-14-13-5-3-12(25)10-11(13)2-4-15(14)16(24)6-7-17(24)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h10,13-21,23,26-28H,2-9H2,1H3,(H,29,30)/t13-,14+,15+,16-,17-,18-,19-,20-,21?,23+,24-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
17-b-Nandrolone glucuronide potassium salt
CAS:Controlled Product17-b-Nandrolone glucuronide potassium salt is a complex carbohydrate that is synthesized by our custom synthesis group. It has the following properties: high purity, methylation, glycosylation, and click modification. This product is a sugar that contains saccharide and oligosaccharide. Glycosylation is when an oligosaccharide attaches to monosaccharides. This product can be used in the following applications: Carbohydrate Modification, Fluorination, Synthetic Custom synthesis.Formula:C24H34O8Purity:Min. 95%Molecular weight:450.53 g/mol

