CAS 13177-26-9
:2-Fluoranthenamine
Description:
2-Fluoranthenamine, with the CAS number 13177-26-9, is a chemical compound that belongs to the class of fluoroanilines. It features a fluoro group attached to an anthenamine structure, which is derived from anthracene. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of the fluorine atom can influence its electronic properties, making it a subject of interest in various chemical applications, including organic synthesis and materials science. 2-Fluoranthenamine may exhibit specific solubility characteristics in organic solvents, and its reactivity can be influenced by the functional groups present in its structure. As with many aromatic amines, it may also be of interest in the study of biological activity and environmental impact. Safety data should be consulted for handling and usage, as aromatic amines can pose health risks. Overall, 2-Fluoranthenamine represents a unique compound with potential applications in both research and industry.
Formula:C16H11N
InChI:InChI=1S/C16H11N/c17-11-8-10-4-3-7-14-12-5-1-2-6-13(12)15(9-11)16(10)14/h1-9H,17H2
InChI key:InChIKey=FREJZSNCUFQJEK-UHFFFAOYSA-N
SMILES:NC1=CC2=C3C(C=4C2=CC=CC4)=CC=CC3=C1
Synonyms:- 2-Aminofluoranthene
- 2-Fluoranthenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
