CAS 13177-27-0
:7-Fluoranthenamine
Description:
7-Fluoranthenamine, identified by its CAS number 13177-27-0, is a chemical compound that belongs to the class of fluoroanthenes. It features a fused polycyclic aromatic structure, which is characterized by the presence of a fluorine atom attached to the anthenamine framework. This compound is notable for its potential applications in various fields, including organic synthesis and materials science, due to its unique electronic properties and stability. The presence of the fluorine atom can influence the compound's reactivity, solubility, and interaction with biological systems. Additionally, 7-Fluoranthenamine may exhibit interesting photophysical properties, making it a candidate for studies in fluorescence and photochemistry. However, detailed information regarding its toxicity, environmental impact, and specific applications may require further investigation, as such data can vary based on experimental conditions and the context of use. As with many chemical substances, safety precautions should be observed when handling 7-Fluoranthenamine in laboratory settings.
Formula:C16H11N
InChI:InChI=1S/C16H11N/c17-14-9-3-7-12-11-6-1-4-10-5-2-8-13(15(10)11)16(12)14/h1-9H,17H2
InChI key:InChIKey=AECDQNMVIJWYBL-UHFFFAOYSA-N
SMILES:NC1=C2C=3C4=C(C2=CC=C1)C=CC=C4C=CC3
Synonyms:- 7-Aminofluoranthene
- 7-Fluoranthenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
