CymitQuimica logo

CAS 13177-28-1

:

1-Nitrofluoranthene

Description:
1-Nitrofluoranthene is an organic compound belonging to the class of nitroaromatic hydrocarbons. It is characterized by the presence of a nitro group (-NO2) attached to the fluoranthene structure, which consists of a polycyclic aromatic hydrocarbon framework. This compound typically appears as a solid at room temperature and is known for its potential environmental and health impacts, particularly as a pollutant. 1-Nitrofluoranthene is often studied for its reactivity and interactions in various chemical processes, including its role in atmospheric chemistry and its potential as a mutagen. Its solubility properties can vary, influencing its behavior in different solvents and environments. The compound is also of interest in the field of organic electronics and materials science due to its electronic properties. Safety precautions are necessary when handling this substance, as nitroaromatic compounds can pose risks to human health and the environment. Overall, 1-nitrofluoranthene serves as a significant subject of study in both environmental chemistry and material science.
Formula:C16H9NO2
InChI:InChI=1S/C16H9NO2/c18-17(19)14-9-8-10-4-3-7-12-11-5-1-2-6-13(11)16(14)15(10)12/h1-9H
InChI key:InChIKey=AWYZHUPAWKZJSL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C3C(C=4C2=CC=CC4)=CC=CC3=CC1
Synonyms:
  • 1-Nitrofluoranthene
  • Fluoranthene, 1-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.