CAS 13177-29-2
:2-Nitrofluoranthene
Description:
2-Nitrofluoranthene is an organic compound belonging to the class of nitroaromatic compounds, characterized by the presence of a nitro group (-NO2) attached to a fluoranthene backbone. Fluoranthene itself is a polycyclic aromatic hydrocarbon (PAH) composed of four fused benzene rings. The introduction of the nitro group at the 2-position of the fluoranthene structure significantly influences its chemical properties, including its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. It is known for its potential environmental persistence and toxicity, which raises concerns regarding its impact on ecosystems and human health. 2-Nitrofluoranthene can be synthesized through various chemical reactions involving fluoranthene and nitrating agents. Its applications may include use in research settings, particularly in studies related to environmental chemistry and toxicology, as well as in the development of materials with specific electronic properties. Proper handling and disposal are essential due to its hazardous nature.
Formula:C16H9NO2
InChI:InChI=1S/C16H9NO2/c18-17(19)11-8-10-4-3-7-14-12-5-1-2-6-13(12)15(9-11)16(10)14/h1-9H
InChI key:InChIKey=VBCBFNMZBHKVQN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC2=C3C(C=4C2=CC=CC4)=CC=CC3=C1
Synonyms:- Brn 2562312
- Ccris 4010
- Fluoranthene, 2-nitro-
- 2-Nitrofluoranthene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
