
CAS 13177-31-6
:7-Nitrofluoranthene
Description:
7-Nitrofluoranthene is an organic compound belonging to the class of nitroaromatic compounds, characterized by the presence of a nitro group (-NO2) attached to a fluoranthene backbone. Fluoranthene itself is a polycyclic aromatic hydrocarbon (PAH) composed of four fused benzene rings. The introduction of the nitro group at the 7-position alters its chemical properties, making it more polar and potentially more reactive than its parent compound. This compound is typically a solid at room temperature and may exhibit yellow to orange coloration. It is known for its environmental persistence and potential toxicity, particularly in relation to its mutagenic and carcinogenic properties. 7-Nitrofluoranthene is often studied in the context of environmental chemistry, particularly concerning its formation from combustion processes and its impact on human health and ecosystems. Its solubility in organic solvents and limited solubility in water are important characteristics that influence its behavior in environmental matrices. Safety precautions are necessary when handling this compound due to its hazardous nature.
Formula:C16H9NO2
InChI:InChI=1S/C16H9NO2/c18-17(19)14-9-3-7-12-11-6-1-4-10-5-2-8-13(15(10)11)16(12)14/h1-9H
InChI key:InChIKey=JBCOKTTXCKLQBB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C3=C4C(C2=CC=C1)=CC=CC4=CC=C3
Synonyms:- Fluoranthene, 7-nitro-
- 7-Nitrofluoranthene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
